C10H18O4Si — CID 86063697
2-(hydroxymethyl)-3-(2-trimethylsilylethoxy)-2H-furan-5-one (PubChem CID 86063697) has the molecular formula C10H18O4Si and a molecular weight of 230.34 g/mol. Its IUPAC name is 2-(hydroxymethyl)-3-(2-trimethylsilylethoxy)-2H-furan-5-one.
| Compound Name | 2-(hydroxymethyl)-3-(2-trimethylsilylethoxy)-2H-furan-5-one |
|---|---|
| PubChem CID | 86063697 |
| Molecular Formula | C10H18O4Si |
| Molecular Weight | 230.34 g/mol |
| Exact Mass | 230.10 |
| IUPAC Name | 2-(hydroxymethyl)-3-(2-trimethylsilylethoxy)-2H-furan-5-one |
| SMILES | C[Si](C)(C)CCOC1=CC(=O)OC1CO |
| InChI | InChI=1S/C10H18O4Si/c1-15(2,3)5-4-13-8-6-10(12)14-9(8)7-11/h6,9,11H,4-5,7H2,1-3H3 |
| InChIKey | PWVVJHVURGYYGA-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.34 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|