C20H25N3O6 — CID 8606430
N-cyclopentyl-2-[3-(3,4-diethoxyphenyl)-2,4,5-trioxoimidazolidin-1-yl]acetamide (PubChem CID 8606430) has the molecular formula C20H25N3O6 and a molecular weight of 403.44 g/mol. Its IUPAC name is N-cyclopentyl-2-[3-(3,4-diethoxyphenyl)-2,4,5-trioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-cyclopentyl-2-[3-(3,4-diethoxyphenyl)-2,4,5-trioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 8606430 |
| Molecular Formula | C20H25N3O6 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | N-cyclopentyl-2-[3-(3,4-diethoxyphenyl)-2,4,5-trioxoimidazolidin-1-yl]acetamide |
| SMILES | CCOc1ccc(N2C(=O)C(=O)N(CC(=O)NC3CCCC3)C2=O)cc1OCC |
| InChI | InChI=1S/C20H25N3O6/c1-3-28-15-10-9-14(11-16(15)29-4-2)23-19(26)18(25)22(20(23)27)12-17(24)21-13-7-5-6-8-13/h9-11,13H,3-8,12H2,1-2H3,(H,21,24) |
| InChIKey | ZTPBLRUTDDOCJO-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|