C19H23N3O8S — CID 40942047
2-[3-(3,4-diethoxyphenyl)-2,4,5-trioxoimidazolidin-1-yl]-N-[(3S)-1,1-dioxothiolan-3-yl]acetamide (PubChem CID 40942047) has the molecular formula C19H23N3O8S and a molecular weight of 453.47 g/mol. Its IUPAC name is 2-[3-(3,4-diethoxyphenyl)-2,4,5-trioxoimidazolidin-1-yl]-N-[(3S)-1,1-dioxothiolan-3-yl]acetamide.
| Compound Name | 2-[3-(3,4-diethoxyphenyl)-2,4,5-trioxoimidazolidin-1-yl]-N-[(3S)-1,1-dioxothiolan-3-yl]acetamide |
|---|---|
| PubChem CID | 40942047 |
| Molecular Formula | C19H23N3O8S |
| Molecular Weight | 453.47 g/mol |
| Exact Mass | 453.12 |
| IUPAC Name | 2-[3-(3,4-diethoxyphenyl)-2,4,5-trioxoimidazolidin-1-yl]-N-[(3S)-1,1-dioxothiolan-3-yl]acetamide |
| SMILES | CCOc1ccc(N2C(=O)C(=O)N(CC(=O)N[C@H]3CCS(=O)(=O)C3)C2=O)cc1OCC |
| InChI | InChI=1S/C19H23N3O8S/c1-3-29-14-6-5-13(9-15(14)30-4-2)22-18(25)17(24)21(19(22)26)10-16(23)20-12-7-8-31(27,28)11-12/h5-6,9,12H,3-4,7-8,10-11H2,1-2H3,(H,20,23)/t12-/m0/s1 |
| InChIKey | YAQCTMHNLHLQMK-LBPRGKRZSA-N |
| XLogP | 0.08 |
| TPSA | 139.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.47 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|