C18H23N3O6 — CID 8607579
2-[3-(3,4-dipropoxyphenyl)-2,4,5-trioxoimidazolidin-1-yl]-N-methylacetamide (PubChem CID 8607579) has the molecular formula C18H23N3O6 and a molecular weight of 377.40 g/mol. Its IUPAC name is 2-[3-(3,4-dipropoxyphenyl)-2,4,5-trioxoimidazolidin-1-yl]-N-methylacetamide.
| Compound Name | 2-[3-(3,4-dipropoxyphenyl)-2,4,5-trioxoimidazolidin-1-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 8607579 |
| Molecular Formula | C18H23N3O6 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | 2-[3-(3,4-dipropoxyphenyl)-2,4,5-trioxoimidazolidin-1-yl]-N-methylacetamide |
| SMILES | CCCOc1ccc(N2C(=O)C(=O)N(CC(=O)NC)C2=O)cc1OCCC |
| InChI | InChI=1S/C18H23N3O6/c1-4-8-26-13-7-6-12(10-14(13)27-9-5-2)21-17(24)16(23)20(18(21)25)11-15(22)19-3/h6-7,10H,4-5,8-9,11H2,1-3H3,(H,19,22) |
| InChIKey | KHUZMBKGTATHIM-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|