C11H7N3OS — CID 86066277
2-cyano-5-phenyl-1,3-thiazole-4-carboxamide (PubChem CID 86066277) has the molecular formula C11H7N3OS and a molecular weight of 229.26 g/mol. Its IUPAC name is 2-cyano-5-phenyl-1,3-thiazole-4-carboxamide.
| Compound Name | 2-cyano-5-phenyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 86066277 |
| Molecular Formula | C11H7N3OS |
| Molecular Weight | 229.26 g/mol |
| Exact Mass | 229.03 |
| IUPAC Name | 2-cyano-5-phenyl-1,3-thiazole-4-carboxamide |
| SMILES | N#Cc1nc(C(N)=O)c(-c2ccccc2)s1 |
| InChI | InChI=1S/C11H7N3OS/c12-6-8-14-9(11(13)15)10(16-8)7-4-2-1-3-5-7/h1-5H,(H2,13,15) |
| InChIKey | XGEVGVODWWYNPH-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 79.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.26 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |