C12H27BGeO2 — CID 86067037
1-(1,3,2-dioxaborinan-2-yl)hexyl-trimethylgermane (PubChem CID 86067037) has the molecular formula C12H27BGeO2 and a molecular weight of 286.77 g/mol. Its IUPAC name is 1-(1,3,2-dioxaborinan-2-yl)hexyl-trimethylgermane.
| Compound Name | 1-(1,3,2-dioxaborinan-2-yl)hexyl-trimethylgermane |
|---|---|
| PubChem CID | 86067037 |
| Molecular Formula | C12H27BGeO2 |
| Molecular Weight | 286.77 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | 1-(1,3,2-dioxaborinan-2-yl)hexyl-trimethylgermane |
| SMILES | CCCCCC(B1OCCCO1)[Ge](C)(C)C |
| InChI | InChI=1S/C12H27BGeO2/c1-5-6-7-9-12(14(2,3)4)13-15-10-8-11-16-13/h12H,5-11H2,1-4H3 |
| InChIKey | JLKQKCLVCDCVIA-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.77 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|