C9H10Br2O3 — CID 86081564
(7,7-dibromo-4-oxo-3-bicyclo[4.1.0]heptanyl) acetate (PubChem CID 86081564) has the molecular formula C9H10Br2O3 and a molecular weight of 325.98 g/mol. Its IUPAC name is (7,7-dibromo-4-oxo-3-bicyclo[4.1.0]heptanyl) acetate.
| Compound Name | (7,7-dibromo-4-oxo-3-bicyclo[4.1.0]heptanyl) acetate |
|---|---|
| PubChem CID | 86081564 |
| Molecular Formula | C9H10Br2O3 |
| Molecular Weight | 325.98 g/mol |
| Exact Mass | 323.90 |
| IUPAC Name | (7,7-dibromo-4-oxo-3-bicyclo[4.1.0]heptanyl) acetate |
| SMILES | CC(=O)OC1CC2C(CC1=O)C2(Br)Br |
| InChI | InChI=1S/C9H10Br2O3/c1-4(12)14-8-3-6-5(2-7(8)13)9(6,10)11/h5-6,8H,2-3H2,1H3 |
| InChIKey | ZZJHISUXJDRILG-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.98 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|