C8HF16N3 — CID 86154930
8-azido-1,1,1,2,2,3,3,4,4,5,5,6,6,7,8,8-hexadecafluorooctane (PubChem CID 86154930) has the molecular formula C8HF16N3 and a molecular weight of 443.09 g/mol. Its IUPAC name is 8-azido-1,1,1,2,2,3,3,4,4,5,5,6,6,7,8,8-hexadecafluorooctane.
| Compound Name | 8-azido-1,1,1,2,2,3,3,4,4,5,5,6,6,7,8,8-hexadecafluorooctane |
|---|---|
| PubChem CID | 86154930 |
| Molecular Formula | C8HF16N3 |
| Molecular Weight | 443.09 g/mol |
| Exact Mass | 442.99 |
| IUPAC Name | 8-azido-1,1,1,2,2,3,3,4,4,5,5,6,6,7,8,8-hexadecafluorooctane |
| SMILES | [N-]=[N+]=NC(F)(F)C(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8HF16N3/c9-1(3(12,13)26-27-25)2(10,11)4(14,15)5(16,17)6(18,19)7(20,21)8(22,23)24/h1H |
| InChIKey | GRSWUPNPRBQKBJ-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.09 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|