C12H20O2 — CID 86155607
2-cyclopentyl-4,7-dimethyl-4,7-dihydro-1,3-dioxepine (PubChem CID 86155607) has the molecular formula C12H20O2 and a molecular weight of 196.29 g/mol. Its IUPAC name is 2-cyclopentyl-4,7-dimethyl-4,7-dihydro-1,3-dioxepine.
| Compound Name | 2-cyclopentyl-4,7-dimethyl-4,7-dihydro-1,3-dioxepine |
|---|---|
| PubChem CID | 86155607 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | 2-cyclopentyl-4,7-dimethyl-4,7-dihydro-1,3-dioxepine |
| SMILES | CC1C=CC(C)OC(C2CCCC2)O1 |
| InChI | InChI=1S/C12H20O2/c1-9-7-8-10(2)14-12(13-9)11-5-3-4-6-11/h7-12H,3-6H2,1-2H3 |
| InChIKey | FKALZNDCRYZCSF-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|