About butyl 4-nitrobenzenesulfinate
butyl 4-nitrobenzenesulfinate (PubChem CID 86164015) has the molecular formula C10H13NO4S
and a molecular weight of 243.28 g/mol. Its IUPAC name is butyl 4-nitrobenzenesulfinate.
Molecular Properties
| Compound Name | butyl 4-nitrobenzenesulfinate |
| PubChem CID | 86164015 |
| Molecular Formula | C10H13NO4S |
| Molecular Weight | 243.28 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | butyl 4-nitrobenzenesulfinate |
| SMILES | CCCCOS(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C10H13NO4S/c1-2-3-8-15-16(14)10-6-4-9(5-7-10)11(12)13/h4-7H,2-3,8H2,1H3 |
| InChIKey | XTKKOSGQQAXTDD-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.28 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze butyl 4-nitrobenzenesulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl 4-nitrobenzenesulfinate?
The IUPAC name of butyl 4-nitrobenzenesulfinate (CID 86164015) is butyl 4-nitrobenzenesulfinate.
What is the SMILES notation for butyl 4-nitrobenzenesulfinate?
The canonical SMILES for butyl 4-nitrobenzenesulfinate is CCCCOS(=O)c1ccc([N+](=O)[O-])cc1.
What is the InChIKey of butyl 4-nitrobenzenesulfinate?
The InChIKey is XTKKOSGQQAXTDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO4S/c1-2-3-8-15-16(14)10-6-4-9(5-7-10)11(12)13/h4-7H,2-3,8H2,1H3.
What are the key properties of butyl 4-nitrobenzenesulfinate?
butyl 4-nitrobenzenesulfinate has a molecular weight of 243.28 g/mol, XLogP of 2.43, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butyl 4-nitrobenzenesulfinate is sourced from PubChem (CID 86164015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).