C7H4F10O2 — CID 86167769
2,2-bis(1,1,2,2,2-pentafluoroethyl)-1,3-dioxolane (PubChem CID 86167769) has the molecular formula C7H4F10O2 and a molecular weight of 310.09 g/mol. Its IUPAC name is 2,2-bis(1,1,2,2,2-pentafluoroethyl)-1,3-dioxolane.
| Compound Name | 2,2-bis(1,1,2,2,2-pentafluoroethyl)-1,3-dioxolane |
|---|---|
| PubChem CID | 86167769 |
| Molecular Formula | C7H4F10O2 |
| Molecular Weight | 310.09 g/mol |
| Exact Mass | 310.01 |
| IUPAC Name | 2,2-bis(1,1,2,2,2-pentafluoroethyl)-1,3-dioxolane |
| SMILES | FC(F)(F)C(F)(F)C1(C(F)(F)C(F)(F)F)OCCO1 |
| InChI | InChI=1S/C7H4F10O2/c8-3(9,6(12,13)14)5(18-1-2-19-5)4(10,11)7(15,16)17/h1-2H2 |
| InChIKey | NOKWHYOCQJPGRQ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.09 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|