C17H15O2S2+ — CID 86183556
3-(2,4-dimethoxyphenyl)-5-phenyldithiol-1-ium (PubChem CID 86183556) has the molecular formula C17H15O2S2+ and a molecular weight of 315.44 g/mol. Its IUPAC name is 3-(2,4-dimethoxyphenyl)-5-phenyldithiol-1-ium.
| Compound Name | 3-(2,4-dimethoxyphenyl)-5-phenyldithiol-1-ium |
|---|---|
| PubChem CID | 86183556 |
| Molecular Formula | C17H15O2S2+ |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | 3-(2,4-dimethoxyphenyl)-5-phenyldithiol-1-ium |
| SMILES | COc1ccc(-c2cc(-c3ccccc3)[s+]s2)c(OC)c1 |
| InChI | InChI=1S/C17H15O2S2/c1-18-13-8-9-14(15(10-13)19-2)17-11-16(20-21-17)12-6-4-3-5-7-12/h3-11H,1-2H3/q+1 |
| InChIKey | ZUCIYZRVLDXYAS-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|