C17H17F2I — CID 86196403
1-fluoro-2-[2-(2-fluoro-4-propylphenyl)ethyl]-3-iodobenzene (PubChem CID 86196403) has the molecular formula C17H17F2I and a molecular weight of 386.22 g/mol. Its IUPAC name is 1-fluoro-2-[2-(2-fluoro-4-propylphenyl)ethyl]-3-iodobenzene.
| Compound Name | 1-fluoro-2-[2-(2-fluoro-4-propylphenyl)ethyl]-3-iodobenzene |
|---|---|
| PubChem CID | 86196403 |
| Molecular Formula | C17H17F2I |
| Molecular Weight | 386.22 g/mol |
| Exact Mass | 386.03 |
| IUPAC Name | 1-fluoro-2-[2-(2-fluoro-4-propylphenyl)ethyl]-3-iodobenzene |
| SMILES | CCCc1ccc(CCc2c(F)cccc2I)c(F)c1 |
| InChI | InChI=1S/C17H17F2I/c1-2-4-12-7-8-13(16(19)11-12)9-10-14-15(18)5-3-6-17(14)20/h3,5-8,11H,2,4,9-10H2,1H3 |
| InChIKey | MZUOXLCOZUSMRX-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.22 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|