C25H34OSSi — CID 86205251
1-[dimethyl(phenyl)silyl]-4,6-dimethyl-3-phenylsulfanylnon-1-yn-5-ol (PubChem CID 86205251) has the molecular formula C25H34OSSi and a molecular weight of 410.70 g/mol. Its IUPAC name is 1-[dimethyl(phenyl)silyl]-4,6-dimethyl-3-phenylsulfanylnon-1-yn-5-ol.
| Compound Name | 1-[dimethyl(phenyl)silyl]-4,6-dimethyl-3-phenylsulfanylnon-1-yn-5-ol |
|---|---|
| PubChem CID | 86205251 |
| Molecular Formula | C25H34OSSi |
| Molecular Weight | 410.70 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | 1-[dimethyl(phenyl)silyl]-4,6-dimethyl-3-phenylsulfanylnon-1-yn-5-ol |
| SMILES | CCCC(C)C(O)C(C)C(C#C[Si](C)(C)c1ccccc1)Sc1ccccc1 |
| InChI | InChI=1S/C25H34OSSi/c1-6-13-20(2)25(26)21(3)24(27-22-14-9-7-10-15-22)18-19-28(4,5)23-16-11-8-12-17-23/h7-12,14-17,20-21,24-26H,6,13H2,1-5H3 |
| InChIKey | NVXRIYGWFGFKIK-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.70 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|