About CID 86209983
CID 86209983 (PubChem CID 86209983) has the molecular formula C9H12NO3S+
and a molecular weight of 214.27 g/mol.
Molecular Properties
| Compound Name | CID 86209983 |
| PubChem CID | 86209983 |
| Molecular Formula | C9H12NO3S+ |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.05 |
| IUPAC Name | — |
| SMILES | C[S+](C)(=O)Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C9H12NO3S/c1-14(2,13)7-8-3-5-9(6-4-8)10(11)12/h3-6H,7H2,1-2H3/q+1 |
| InChIKey | OQMVEIPGSPHZHK-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 86209983 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 86209983?
The IUPAC name of CID 86209983 (CID 86209983) is not available.
What is the SMILES notation for CID 86209983?
The canonical SMILES for CID 86209983 is C[S+](C)(=O)Cc1ccc([N+](=O)[O-])cc1.
What is the InChIKey of CID 86209983?
The InChIKey is OQMVEIPGSPHZHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12NO3S/c1-14(2,13)7-8-3-5-9(6-4-8)10(11)12/h3-6H,7H2,1-2H3/q+1.
What are the key properties of CID 86209983?
CID 86209983 has a molecular weight of 214.27 g/mol, XLogP of 1.85, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 86209983 is sourced from PubChem (CID 86209983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).