C5H10ClN — CID 86211686
1-chloro-N,2-dimethylprop-1-en-1-amine (PubChem CID 86211686) has the molecular formula C5H10ClN and a molecular weight of 119.59 g/mol. Its IUPAC name is 1-chloro-N,2-dimethylprop-1-en-1-amine.
| Compound Name | 1-chloro-N,2-dimethylprop-1-en-1-amine |
|---|---|
| PubChem CID | 86211686 |
| Molecular Formula | C5H10ClN |
| Molecular Weight | 119.59 g/mol |
| Exact Mass | 119.05 |
| IUPAC Name | 1-chloro-N,2-dimethylprop-1-en-1-amine |
| SMILES | CNC(Cl)=C(C)C |
| InChI | InChI=1S/C5H10ClN/c1-4(2)5(6)7-3/h7H,1-3H3 |
| InChIKey | WMEKCNWTGPTJMQ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 119.59 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|