C8H15Cl2N — CID 174088047
(E,4S)-2,5-dichloro-N,4-dimethylhex-2-en-3-amine (PubChem CID 174088047) has the molecular formula C8H15Cl2N and a molecular weight of 196.12 g/mol. Its IUPAC name is (E,4S)-2,5-dichloro-N,4-dimethylhex-2-en-3-amine.
| Compound Name | (E,4S)-2,5-dichloro-N,4-dimethylhex-2-en-3-amine |
|---|---|
| PubChem CID | 174088047 |
| Molecular Formula | C8H15Cl2N |
| Molecular Weight | 196.12 g/mol |
| Exact Mass | 195.06 |
| IUPAC Name | (E,4S)-2,5-dichloro-N,4-dimethylhex-2-en-3-amine |
| SMILES | CN/C(=C(\C)Cl)[C@H](C)C(C)Cl |
| InChI | InChI=1S/C8H15Cl2N/c1-5(6(2)9)8(11-4)7(3)10/h5-6,11H,1-4H3/b8-7+/t5-,6?/m1/s1 |
| InChIKey | JZOZCURICLAKMM-FQIBTTFDSA-N |
| XLogP | 2.94 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.12 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|