C19H30OSi — CID 86212793
triethyl(4-phenylhepta-1,6-dien-2-yloxy)silane (PubChem CID 86212793) has the molecular formula C19H30OSi and a molecular weight of 302.53 g/mol. Its IUPAC name is triethyl(4-phenylhepta-1,6-dien-2-yloxy)silane.
| Compound Name | triethyl(4-phenylhepta-1,6-dien-2-yloxy)silane |
|---|---|
| PubChem CID | 86212793 |
| Molecular Formula | C19H30OSi |
| Molecular Weight | 302.53 g/mol |
| Exact Mass | 302.21 |
| IUPAC Name | triethyl(4-phenylhepta-1,6-dien-2-yloxy)silane |
| SMILES | C=CCC(CC(=C)O[Si](CC)(CC)CC)c1ccccc1 |
| InChI | InChI=1S/C19H30OSi/c1-6-13-19(18-14-11-10-12-15-18)16-17(5)20-21(7-2,8-3)9-4/h6,10-12,14-15,19H,1,5,7-9,13,16H2,2-4H3 |
| InChIKey | QFJMOSXKZZLXDN-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.53 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|