C12H13O2+ — CID 86217886
7-methoxy-1,3-dimethylisochromenylium (PubChem CID 86217886) has the molecular formula C12H13O2+ and a molecular weight of 189.23 g/mol. Its IUPAC name is 7-methoxy-1,3-dimethylisochromenylium.
| Compound Name | 7-methoxy-1,3-dimethylisochromenylium |
|---|---|
| PubChem CID | 86217886 |
| Molecular Formula | C12H13O2+ |
| Molecular Weight | 189.23 g/mol |
| Exact Mass | 189.09 |
| IUPAC Name | 7-methoxy-1,3-dimethylisochromenylium |
| SMILES | COc1ccc2cc(C)[o+]c(C)c2c1 |
| InChI | InChI=1S/C12H13O2/c1-8-6-10-4-5-11(13-3)7-12(10)9(2)14-8/h4-7H,1-3H3/q+1 |
| InChIKey | PRYYFMSHPOMFIS-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 20.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.23 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|