C22H23O5+ — CID 173307400
1-[2-(2,4-dimethoxyphenyl)ethenyl]-6,7-dimethoxy-3-methylisochromenylium (PubChem CID 173307400) has the molecular formula C22H23O5+ and a molecular weight of 367.42 g/mol. Its IUPAC name is 1-[2-(2,4-dimethoxyphenyl)ethenyl]-6,7-dimethoxy-3-methylisochromenylium.
| Compound Name | 1-[2-(2,4-dimethoxyphenyl)ethenyl]-6,7-dimethoxy-3-methylisochromenylium |
|---|---|
| PubChem CID | 173307400 |
| Molecular Formula | C22H23O5+ |
| Molecular Weight | 367.42 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | 1-[2-(2,4-dimethoxyphenyl)ethenyl]-6,7-dimethoxy-3-methylisochromenylium |
| SMILES | COc1ccc(C=Cc2[o+]c(C)cc3cc(OC)c(OC)cc23)c(OC)c1 |
| InChI | InChI=1S/C22H23O5/c1-14-10-16-11-21(25-4)22(26-5)13-18(16)19(27-14)9-7-15-6-8-17(23-2)12-20(15)24-3/h6-13H,1-5H3/q+1 |
| InChIKey | SJUUANOJHIVQEV-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 48.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.42 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|