C10H6OTe — CID 86218461
2-oxa-3-telluratricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene (PubChem CID 86218461) has the molecular formula C10H6OTe and a molecular weight of 269.76 g/mol. Its IUPAC name is 2-oxa-3-telluratricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene.
| Compound Name | 2-oxa-3-telluratricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene |
|---|---|
| PubChem CID | 86218461 |
| Molecular Formula | C10H6OTe |
| Molecular Weight | 269.76 g/mol |
| Exact Mass | 271.95 |
| IUPAC Name | 2-oxa-3-telluratricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene |
| SMILES | c1cc2c3c(cccc3c1)[Te]O2 |
| InChI | InChI=1S/C10H6OTe/c1-3-7-4-2-6-9-10(7)8(5-1)11-12-9/h1-6H |
| InChIKey | IDZBQHJRPGZJNU-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.76 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|