C17H9F4IN2OS — CID 86232371
N-[4-[2-fluoro-3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]-4-iodobenzamide (PubChem CID 86232371) has the molecular formula C17H9F4IN2OS and a molecular weight of 492.24 g/mol. Its IUPAC name is N-[4-[2-fluoro-3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]-4-iodobenzamide.
| Compound Name | N-[4-[2-fluoro-3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]-4-iodobenzamide |
|---|---|
| PubChem CID | 86232371 |
| Molecular Formula | C17H9F4IN2OS |
| Molecular Weight | 492.24 g/mol |
| Exact Mass | 491.94 |
| IUPAC Name | N-[4-[2-fluoro-3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]-4-iodobenzamide |
| SMILES | O=C(Nc1nc(-c2cccc(C(F)(F)F)c2F)cs1)c1ccc(I)cc1 |
| InChI | InChI=1S/C17H9F4IN2OS/c18-14-11(2-1-3-12(14)17(19,20)21)13-8-26-16(23-13)24-15(25)9-4-6-10(22)7-5-9/h1-8H,(H,23,24,25) |
| InChIKey | MEVKQDIJUNRWKF-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.24 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|