C13H15N3O3 — CID 86266819
ethyl 4-oxo-4-(pyrazolo[1,5-a]pyridin-5-ylamino)butanoate (PubChem CID 86266819) has the molecular formula C13H15N3O3 and a molecular weight of 261.28 g/mol. Its IUPAC name is ethyl 4-oxo-4-(pyrazolo[1,5-a]pyridin-5-ylamino)butanoate.
| Compound Name | ethyl 4-oxo-4-(pyrazolo[1,5-a]pyridin-5-ylamino)butanoate |
|---|---|
| PubChem CID | 86266819 |
| Molecular Formula | C13H15N3O3 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | ethyl 4-oxo-4-(pyrazolo[1,5-a]pyridin-5-ylamino)butanoate |
| SMILES | CCOC(=O)CCC(=O)Nc1ccn2nccc2c1 |
| InChI | InChI=1S/C13H15N3O3/c1-2-19-13(18)4-3-12(17)15-10-6-8-16-11(9-10)5-7-14-16/h5-9H,2-4H2,1H3,(H,15,17) |
| InChIKey | RAQLUZOINSCVEK-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |