C25H31NO6 — CID 86272954
(E)-1-(2,6-dimethoxyphenyl)-3-[6-hydroxy-2,4-dimethoxy-3-(1-methylpiperidin-4-yl)phenyl]prop-2-en-1-one (PubChem CID 86272954) has the molecular formula C25H31NO6 and a molecular weight of 441.52 g/mol. Its IUPAC name is (E)-1-(2,6-dimethoxyphenyl)-3-[6-hydroxy-2,4-dimethoxy-3-(1-methylpiperidin-4-yl)phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-(2,6-dimethoxyphenyl)-3-[6-hydroxy-2,4-dimethoxy-3-(1-methylpiperidin-4-yl)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 86272954 |
| Molecular Formula | C25H31NO6 |
| Molecular Weight | 441.52 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | (E)-1-(2,6-dimethoxyphenyl)-3-[6-hydroxy-2,4-dimethoxy-3-(1-methylpiperidin-4-yl)phenyl]prop-2-en-1-one |
| SMILES | COc1cccc(OC)c1C(=O)/C=C/c1c(O)cc(OC)c(C2CCN(C)CC2)c1OC |
| InChI | InChI=1S/C25H31NO6/c1-26-13-11-16(12-14-26)23-22(31-4)15-19(28)17(25(23)32-5)9-10-18(27)24-20(29-2)7-6-8-21(24)30-3/h6-10,15-16,28H,11-14H2,1-5H3/b10-9+ |
| InChIKey | PMXRGGJNFDPWNP-MDZDMXLPSA-N |
| XLogP | 4.13 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.52 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|