C30H31FN2O3 — CID 86279701
(3S)-3-[4-[[4-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]phenyl]methoxy]phenyl]hex-4-ynoic acid (PubChem CID 86279701) has the molecular formula C30H31FN2O3 and a molecular weight of 486.59 g/mol. Its IUPAC name is (3S)-3-[4-[[4-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]phenyl]methoxy]phenyl]hex-4-ynoic acid.
| Compound Name | (3S)-3-[4-[[4-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]phenyl]methoxy]phenyl]hex-4-ynoic acid |
|---|---|
| PubChem CID | 86279701 |
| Molecular Formula | C30H31FN2O3 |
| Molecular Weight | 486.59 g/mol |
| Exact Mass | 486.23 |
| IUPAC Name | (3S)-3-[4-[[4-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]phenyl]methoxy]phenyl]hex-4-ynoic acid |
| SMILES | CC#C[C@@H](CC(=O)O)c1ccc(OCc2ccc(CN3CCN(c4ccc(F)cc4)CC3)cc2)cc1 |
| InChI | InChI=1S/C30H31FN2O3/c1-2-3-26(20-30(34)35)25-8-14-29(15-9-25)36-22-24-6-4-23(5-7-24)21-32-16-18-33(19-17-32)28-12-10-27(31)11-13-28/h4-15,26H,16-22H2,1H3,(H,34,35)/t26-/m0/s1 |
| InChIKey | AVVDTZVMFXUHED-SANMLTNESA-N |
| XLogP | 5.31 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.59 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|