C34H35NO6 — CID 86280554
methyl (6S,6aS,10R,10aS)-10-[(2E)-2-[(4S)-4-benzoyloxy-2-oxooxolan-3-ylidene]ethyl]-6,10a-dimethyl-9-methylidene-5,6a,7,8,10,11-hexahydrobenzo[b]carbazole-6-carboxylate (PubChem CID 86280554) has the molecular formula C34H35NO6 and a molecular weight of 553.66 g/mol. Its IUPAC name is methyl (6S,6aS,10R,10aS)-10-[(2E)-2-[(4S)-4-benzoyloxy-2-oxooxolan-3-ylidene]ethyl]-6,10a-dimethyl-9-methylidene-5,6a,7,8,10,11-hexahydrobenzo[b]carbazole-6-carboxylate.
| Compound Name | methyl (6S,6aS,10R,10aS)-10-[(2E)-2-[(4S)-4-benzoyloxy-2-oxooxolan-3-ylidene]ethyl]-6,10a-dimethyl-9-methylidene-5,6a,7,8,10,11-hexahydrobenzo[b]carbazole-6-carboxylate |
|---|---|
| PubChem CID | 86280554 |
| Molecular Formula | C34H35NO6 |
| Molecular Weight | 553.66 g/mol |
| Exact Mass | 553.25 |
| IUPAC Name | methyl (6S,6aS,10R,10aS)-10-[(2E)-2-[(4S)-4-benzoyloxy-2-oxooxolan-3-ylidene]ethyl]-6,10a-dimethyl-9-methylidene-5,6a,7,8,10,11-hexahydrobenzo[b]carbazole-6-carboxylate |
| SMILES | C=C1CC[C@H]2[C@@](C)(Cc3c([nH]c4ccccc34)[C@@]2(C)C(=O)OC)[C@@H]1C/C=C1/C(=O)OC[C@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C34H35NO6/c1-20-14-17-28-33(2,18-24-22-12-8-9-13-26(22)35-29(24)34(28,3)32(38)39-4)25(20)16-15-23-27(19-40-31(23)37)41-30(36)21-10-6-5-7-11-21/h5-13,15,25,27-28,35H,1,14,16-19H2,2-4H3/b23-15+/t25-,27-,28+,33+,34+/m1/s1 |
| InChIKey | UZPUPSINROTBSE-UDUAXWAMSA-N |
| XLogP | 5.84 |
| TPSA | 94.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.66 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|