C24H34N2O2S — CID 8628408
3-(2,3-dimethylphenyl)-1-[(3-ethoxy-4-propoxyphenyl)methyl]-1-propylthiourea (PubChem CID 8628408) has the molecular formula C24H34N2O2S and a molecular weight of 414.62 g/mol. Its IUPAC name is 3-(2,3-dimethylphenyl)-1-[(3-ethoxy-4-propoxyphenyl)methyl]-1-propylthiourea.
| Compound Name | 3-(2,3-dimethylphenyl)-1-[(3-ethoxy-4-propoxyphenyl)methyl]-1-propylthiourea |
|---|---|
| PubChem CID | 8628408 |
| Molecular Formula | C24H34N2O2S |
| Molecular Weight | 414.62 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | 3-(2,3-dimethylphenyl)-1-[(3-ethoxy-4-propoxyphenyl)methyl]-1-propylthiourea |
| SMILES | CCCOc1ccc(CN(CCC)C(=S)Nc2cccc(C)c2C)cc1OCC |
| InChI | InChI=1S/C24H34N2O2S/c1-6-14-26(24(29)25-21-11-9-10-18(4)19(21)5)17-20-12-13-22(28-15-7-2)23(16-20)27-8-3/h9-13,16H,6-8,14-15,17H2,1-5H3,(H,25,29) |
| InChIKey | IKBHKDPKOFGMFB-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.62 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|