C16H11Cl2NO4 — CID 86292470
4-[(4,6-dichloro-7-hydroxyindol-1-yl)methyl]-2-hydroxybenzoic acid (PubChem CID 86292470) has the molecular formula C16H11Cl2NO4 and a molecular weight of 352.17 g/mol. Its IUPAC name is 4-[(4,6-dichloro-7-hydroxyindol-1-yl)methyl]-2-hydroxybenzoic acid.
| Compound Name | 4-[(4,6-dichloro-7-hydroxyindol-1-yl)methyl]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 86292470 |
| Molecular Formula | C16H11Cl2NO4 |
| Molecular Weight | 352.17 g/mol |
| Exact Mass | 351.01 |
| IUPAC Name | 4-[(4,6-dichloro-7-hydroxyindol-1-yl)methyl]-2-hydroxybenzoic acid |
| SMILES | O=C(O)c1ccc(Cn2ccc3c(Cl)cc(Cl)c(O)c32)cc1O |
| InChI | InChI=1S/C16H11Cl2NO4/c17-11-6-12(18)15(21)14-9(11)3-4-19(14)7-8-1-2-10(16(22)23)13(20)5-8/h1-6,20-21H,7H2,(H,22,23) |
| InChIKey | KPPDQRXNHJMVDI-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 82.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.17 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |