C22H29NO3 — CID 86297494
ethyl 2-(3-hydroxy-1-adamantyl)-2-[(1R)-1-phenylethyl]iminoacetate (PubChem CID 86297494) has the molecular formula C22H29NO3 and a molecular weight of 355.48 g/mol. Its IUPAC name is ethyl 2-(3-hydroxy-1-adamantyl)-2-[(1R)-1-phenylethyl]iminoacetate.
| Compound Name | ethyl 2-(3-hydroxy-1-adamantyl)-2-[(1R)-1-phenylethyl]iminoacetate |
|---|---|
| PubChem CID | 86297494 |
| Molecular Formula | C22H29NO3 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.21 |
| IUPAC Name | ethyl 2-(3-hydroxy-1-adamantyl)-2-[(1R)-1-phenylethyl]iminoacetate |
| SMILES | CCOC(=O)/C(=N\[C@H](C)c1ccccc1)C12CC3CC(CC(O)(C3)C1)C2 |
| InChI | InChI=1S/C22H29NO3/c1-3-26-20(24)19(23-15(2)18-7-5-4-6-8-18)21-10-16-9-17(11-21)13-22(25,12-16)14-21/h4-8,15-17,25H,3,9-14H2,1-2H3/b23-19+/t15-,16?,17?,21?,22?/m1/s1 |
| InChIKey | XMUPATICNDXGBH-FAUSHLBWSA-N |
| XLogP | 4.08 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|