C25H29N3O2 — CID 86582575
2-[2-benzylimino-2-(3-hydroxy-1-adamantyl)acetyl]-2-azabicyclo[3.1.0]hexane-3-carbonitrile (PubChem CID 86582575) has the molecular formula C25H29N3O2 and a molecular weight of 403.53 g/mol. Its IUPAC name is 2-[2-benzylimino-2-(3-hydroxy-1-adamantyl)acetyl]-2-azabicyclo[3.1.0]hexane-3-carbonitrile.
| Compound Name | 2-[2-benzylimino-2-(3-hydroxy-1-adamantyl)acetyl]-2-azabicyclo[3.1.0]hexane-3-carbonitrile |
|---|---|
| PubChem CID | 86582575 |
| Molecular Formula | C25H29N3O2 |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.23 |
| IUPAC Name | 2-[2-benzylimino-2-(3-hydroxy-1-adamantyl)acetyl]-2-azabicyclo[3.1.0]hexane-3-carbonitrile |
| SMILES | N#CC1CC2CC2N1C(=O)/C(=N\Cc1ccccc1)C12CC3CC(CC(O)(C3)C1)C2 |
| InChI | InChI=1S/C25H29N3O2/c26-13-20-7-19-8-21(19)28(20)23(29)22(27-14-16-4-2-1-3-5-16)24-9-17-6-18(10-24)12-25(30,11-17)15-24/h1-5,17-21,30H,6-12,14-15H2/b27-22+ |
| InChIKey | OAWJMUPWTZEASL-HPNDGRJYSA-N |
| XLogP | 3.47 |
| TPSA | 76.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|