C21H23NO7 — CID 86302896
1-[(4-methoxyphenyl)carbamoyl]-2-(3,4,5-trimethoxyphenyl)cyclopropane-1-carboxylic acid (PubChem CID 86302896) has the molecular formula C21H23NO7 and a molecular weight of 401.42 g/mol. Its IUPAC name is 1-[(4-methoxyphenyl)carbamoyl]-2-(3,4,5-trimethoxyphenyl)cyclopropane-1-carboxylic acid.
| Compound Name | 1-[(4-methoxyphenyl)carbamoyl]-2-(3,4,5-trimethoxyphenyl)cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 86302896 |
| Molecular Formula | C21H23NO7 |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | 1-[(4-methoxyphenyl)carbamoyl]-2-(3,4,5-trimethoxyphenyl)cyclopropane-1-carboxylic acid |
| SMILES | COc1ccc(NC(=O)C2(C(=O)O)CC2c2cc(OC)c(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C21H23NO7/c1-26-14-7-5-13(6-8-14)22-19(23)21(20(24)25)11-15(21)12-9-16(27-2)18(29-4)17(10-12)28-3/h5-10,15H,11H2,1-4H3,(H,22,23)(H,24,25) |
| InChIKey | BCOFWTGCQOYUFU-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 103.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|