C12H15NO2 — CID 86313571
(3R)-5-ethoxy-1,3-dimethyl-3H-indol-2-one (PubChem CID 86313571) has the molecular formula C12H15NO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is (3R)-5-ethoxy-1,3-dimethyl-3H-indol-2-one.
| Compound Name | (3R)-5-ethoxy-1,3-dimethyl-3H-indol-2-one |
|---|---|
| PubChem CID | 86313571 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | (3R)-5-ethoxy-1,3-dimethyl-3H-indol-2-one |
| SMILES | CCOc1ccc2c(c1)[C@@H](C)C(=O)N2C |
| InChI | InChI=1S/C12H15NO2/c1-4-15-9-5-6-11-10(7-9)8(2)12(14)13(11)3/h5-8H,4H2,1-3H3/t8-/m1/s1 |
| InChIKey | JMRWLRFPUMZEGA-MRVPVSSYSA-N |
| XLogP | 2.17 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |