C17H13ClF3NO4 — CID 8633119
[2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl] 2-(2-chlorophenyl)acetate (PubChem CID 8633119) has the molecular formula C17H13ClF3NO4 and a molecular weight of 387.74 g/mol. Its IUPAC name is [2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl] 2-(2-chlorophenyl)acetate.
| Compound Name | [2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl] 2-(2-chlorophenyl)acetate |
|---|---|
| PubChem CID | 8633119 |
| Molecular Formula | C17H13ClF3NO4 |
| Molecular Weight | 387.74 g/mol |
| Exact Mass | 387.05 |
| IUPAC Name | [2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl] 2-(2-chlorophenyl)acetate |
| SMILES | O=C(COC(=O)Cc1ccccc1Cl)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C17H13ClF3NO4/c18-14-4-2-1-3-11(14)9-16(24)25-10-15(23)22-12-5-7-13(8-6-12)26-17(19,20)21/h1-8H,9-10H2,(H,22,23) |
| InChIKey | BYQAIKZDXDVBQE-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.74 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |