C19H25F2NO5 — CID 86336931
5-(5,5-dimethyl-1,3-dioxan-2-yl)-4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2,3-difluorobenzoic acid (PubChem CID 86336931) has the molecular formula C19H25F2NO5 and a molecular weight of 385.41 g/mol. Its IUPAC name is 5-(5,5-dimethyl-1,3-dioxan-2-yl)-4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2,3-difluorobenzoic acid.
| Compound Name | 5-(5,5-dimethyl-1,3-dioxan-2-yl)-4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2,3-difluorobenzoic acid |
|---|---|
| PubChem CID | 86336931 |
| Molecular Formula | C19H25F2NO5 |
| Molecular Weight | 385.41 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | 5-(5,5-dimethyl-1,3-dioxan-2-yl)-4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2,3-difluorobenzoic acid |
| SMILES | C[C@@H]1CN(c2c(C3OCC(C)(C)CO3)cc(C(=O)O)c(F)c2F)C[C@H](C)O1 |
| InChI | InChI=1S/C19H25F2NO5/c1-10-6-22(7-11(2)27-10)16-13(18-25-8-19(3,4)9-26-18)5-12(17(23)24)14(20)15(16)21/h5,10-11,18H,6-9H2,1-4H3,(H,23,24)/t10-,11+ |
| InChIKey | ISCSOWHGTIRHAD-PHIMTYICSA-N |
| XLogP | 3.35 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.41 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |