C17H18N2O6S — CID 8633901
(2R)-2-(2-formyl-4-methoxyphenoxy)-N-(4-sulfamoylphenyl)propanamide (PubChem CID 8633901) has the molecular formula C17H18N2O6S and a molecular weight of 378.41 g/mol. Its IUPAC name is (2R)-2-(2-formyl-4-methoxyphenoxy)-N-(4-sulfamoylphenyl)propanamide.
| Compound Name | (2R)-2-(2-formyl-4-methoxyphenoxy)-N-(4-sulfamoylphenyl)propanamide |
|---|---|
| PubChem CID | 8633901 |
| Molecular Formula | C17H18N2O6S |
| Molecular Weight | 378.41 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | (2R)-2-(2-formyl-4-methoxyphenoxy)-N-(4-sulfamoylphenyl)propanamide |
| SMILES | COc1ccc(O[C@H](C)C(=O)Nc2ccc(S(N)(=O)=O)cc2)c(C=O)c1 |
| InChI | InChI=1S/C17H18N2O6S/c1-11(25-16-8-5-14(24-2)9-12(16)10-20)17(21)19-13-3-6-15(7-4-13)26(18,22)23/h3-11H,1-2H3,(H,19,21)(H2,18,22,23)/t11-/m1/s1 |
| InChIKey | JURLTZWULVFMCY-LLVKDONJSA-N |
| XLogP | 1.56 |
| TPSA | 124.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.41 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|