C9H5BrCl2O2 — CID 86339676
(3R)-3-bromo-6,7-dichloro-2,3-dihydrochromen-4-one (PubChem CID 86339676) has the molecular formula C9H5BrCl2O2 and a molecular weight of 295.95 g/mol. Its IUPAC name is (3R)-3-bromo-6,7-dichloro-2,3-dihydrochromen-4-one.
| Compound Name | (3R)-3-bromo-6,7-dichloro-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 86339676 |
| Molecular Formula | C9H5BrCl2O2 |
| Molecular Weight | 295.95 g/mol |
| Exact Mass | 293.88 |
| IUPAC Name | (3R)-3-bromo-6,7-dichloro-2,3-dihydrochromen-4-one |
| SMILES | O=C1c2cc(Cl)c(Cl)cc2OC[C@H]1Br |
| InChI | InChI=1S/C9H5BrCl2O2/c10-5-3-14-8-2-7(12)6(11)1-4(8)9(5)13/h1-2,5H,3H2/t5-/m1/s1 |
| InChIKey | MQIQMOQHNJSIAU-RXMQYKEDSA-N |
| XLogP | 3.33 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.95 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|