C9H14N2 — CID 86341099
7-methyl-1,2,3,4,7,8-hexahydro-1,8-naphthyridine (PubChem CID 86341099) has the molecular formula C9H14N2 and a molecular weight of 150.22 g/mol. Its IUPAC name is 7-methyl-1,2,3,4,7,8-hexahydro-1,8-naphthyridine.
| Compound Name | 7-methyl-1,2,3,4,7,8-hexahydro-1,8-naphthyridine |
|---|---|
| PubChem CID | 86341099 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | 7-methyl-1,2,3,4,7,8-hexahydro-1,8-naphthyridine |
| SMILES | CC1C=CC2=C(NCCC2)N1 |
| InChI | InChI=1S/C9H14N2/c1-7-4-5-8-3-2-6-10-9(8)11-7/h4-5,7,10-11H,2-3,6H2,1H3 |
| InChIKey | ASDXNWOUCCGLLV-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |