C7H13N3 — CID 86341166
5-N,2-dimethyl-1,2-dihydropyridine-5,6-diamine (PubChem CID 86341166) has the molecular formula C7H13N3 and a molecular weight of 139.20 g/mol. Its IUPAC name is 5-N,2-dimethyl-1,2-dihydropyridine-5,6-diamine.
| Compound Name | 5-N,2-dimethyl-1,2-dihydropyridine-5,6-diamine |
|---|---|
| PubChem CID | 86341166 |
| Molecular Formula | C7H13N3 |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.11 |
| IUPAC Name | 5-N,2-dimethyl-1,2-dihydropyridine-5,6-diamine |
| SMILES | CNC1=C(N)NC(C)C=C1 |
| InChI | InChI=1S/C7H13N3/c1-5-3-4-6(9-2)7(8)10-5/h3-5,9-10H,8H2,1-2H3 |
| InChIKey | LEPUVOAYBMEPQK-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |