C6H11N3 — CID 86341535
2-N-methyl-1,2-dihydropyridine-2,6-diamine (PubChem CID 86341535) has the molecular formula C6H11N3 and a molecular weight of 125.17 g/mol. Its IUPAC name is 2-N-methyl-1,2-dihydropyridine-2,6-diamine.
| Compound Name | 2-N-methyl-1,2-dihydropyridine-2,6-diamine |
|---|---|
| PubChem CID | 86341535 |
| Molecular Formula | C6H11N3 |
| Molecular Weight | 125.17 g/mol |
| Exact Mass | 125.10 |
| IUPAC Name | 2-N-methyl-1,2-dihydropyridine-2,6-diamine |
| SMILES | CNC1C=CC=C(N)N1 |
| InChI | InChI=1S/C6H11N3/c1-8-6-4-2-3-5(7)9-6/h2-4,6,8-9H,7H2,1H3 |
| InChIKey | NNGUWELMESOURE-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.17 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |