About 7,7a-dihydro-1H-pyrrolo[2,3-b]pyridin-6-amine;ethane
7,7a-dihydro-1H-pyrrolo[2,3-b]pyridin-6-amine;ethane (PubChem CID 144639531) has the molecular formula C9H15N3
and a molecular weight of 165.24 g/mol. Its IUPAC name is 7,7a-dihydro-1H-pyrrolo[2,3-b]pyridin-6-amine;ethane.
Analyze 7,7a-dihydro-1H-pyrrolo[2,3-b]pyridin-6-amine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,7a-dihydro-1H-pyrrolo[2,3-b]pyridin-6-amine;ethane?
The IUPAC name of 7,7a-dihydro-1H-pyrrolo[2,3-b]pyridin-6-amine;ethane (CID 144639531) is 7,7a-dihydro-1H-pyrrolo[2,3-b]pyridin-6-amine;ethane.
What is the SMILES notation for 7,7a-dihydro-1H-pyrrolo[2,3-b]pyridin-6-amine;ethane?
The canonical SMILES for 7,7a-dihydro-1H-pyrrolo[2,3-b]pyridin-6-amine;ethane is CC.NC1=CC=C2C=CNC2N1.
What is the InChIKey of 7,7a-dihydro-1H-pyrrolo[2,3-b]pyridin-6-amine;ethane?
The InChIKey is ONNPKKFZKIUJJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3.C2H6/c8-6-2-1-5-3-4-9-7(5)10-6;1-2/h1-4,7,9-10H,8H2;1-2H3.
What are the key properties of 7,7a-dihydro-1H-pyrrolo[2,3-b]pyridin-6-amine;ethane?
7,7a-dihydro-1H-pyrrolo[2,3-b]pyridin-6-amine;ethane has a molecular weight of 165.24 g/mol, XLogP of 0.79, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7,7a-dihydro-1H-pyrrolo[2,3-b]pyridin-6-amine;ethane is sourced from PubChem (CID 144639531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).