About 5-bromo-1,8a-dihydrocyclohepta[b]pyrrole
5-bromo-1,8a-dihydrocyclohepta[b]pyrrole (PubChem CID 143421690) has the molecular formula C9H8BrN
and a molecular weight of 210.07 g/mol. Its IUPAC name is 5-bromo-1,8a-dihydrocyclohepta[b]pyrrole.
Molecular Properties
| Compound Name | 5-bromo-1,8a-dihydrocyclohepta[b]pyrrole |
| PubChem CID | 143421690 |
| Molecular Formula | C9H8BrN |
| Molecular Weight | 210.07 g/mol |
| Exact Mass | 208.98 |
| IUPAC Name | 5-bromo-1,8a-dihydrocyclohepta[b]pyrrole |
| SMILES | BrC1=CC=CC2NC=CC2=C1 |
| InChI | InChI=1S/C9H8BrN/c10-8-2-1-3-9-7(6-8)4-5-11-9/h1-6,9,11H |
| InChIKey | JYAPOUBRUCKUEH-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.07 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-bromo-1,8a-dihydrocyclohepta[b]pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-1,8a-dihydrocyclohepta[b]pyrrole?
The IUPAC name of 5-bromo-1,8a-dihydrocyclohepta[b]pyrrole (CID 143421690) is 5-bromo-1,8a-dihydrocyclohepta[b]pyrrole.
What is the SMILES notation for 5-bromo-1,8a-dihydrocyclohepta[b]pyrrole?
The canonical SMILES for 5-bromo-1,8a-dihydrocyclohepta[b]pyrrole is BrC1=CC=CC2NC=CC2=C1.
What is the InChIKey of 5-bromo-1,8a-dihydrocyclohepta[b]pyrrole?
The InChIKey is JYAPOUBRUCKUEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8BrN/c10-8-2-1-3-9-7(6-8)4-5-11-9/h1-6,9,11H.
What are the key properties of 5-bromo-1,8a-dihydrocyclohepta[b]pyrrole?
5-bromo-1,8a-dihydrocyclohepta[b]pyrrole has a molecular weight of 210.07 g/mol, XLogP of 2.25, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-1,8a-dihydrocyclohepta[b]pyrrole is sourced from PubChem (CID 143421690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).