C9H8BrN — CID 143421690
5-bromo-1,8a-dihydrocyclohepta[b]pyrrole (PubChem CID 143421690) has the molecular formula C9H8BrN and a molecular weight of 210.07 g/mol. Its IUPAC name is 5-bromo-1,8a-dihydrocyclohepta[b]pyrrole.
| Compound Name | 5-bromo-1,8a-dihydrocyclohepta[b]pyrrole |
|---|---|
| PubChem CID | 143421690 |
| Molecular Formula | C9H8BrN |
| Molecular Weight | 210.07 g/mol |
| Exact Mass | 208.98 |
| IUPAC Name | 5-bromo-1,8a-dihydrocyclohepta[b]pyrrole |
| SMILES | BrC1=CC=CC2NC=CC2=C1 |
| InChI | InChI=1S/C9H8BrN/c10-8-2-1-3-9-7(6-8)4-5-11-9/h1-6,9,11H |
| InChIKey | JYAPOUBRUCKUEH-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.07 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |