C11H16N2 — CID 144947007
1,8a-dihydroquinolin-6-amine;ethane (PubChem CID 144947007) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is 1,8a-dihydroquinolin-6-amine;ethane.
| Compound Name | 1,8a-dihydroquinolin-6-amine;ethane |
|---|---|
| PubChem CID | 144947007 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | 1,8a-dihydroquinolin-6-amine;ethane |
| SMILES | CC.NC1=CC2=CC=CNC2C=C1 |
| InChI | InChI=1S/C9H10N2.C2H6/c10-8-3-4-9-7(6-8)2-1-5-11-9;1-2/h1-6,9,11H,10H2;1-2H3 |
| InChIKey | MUQJRMFWTMIONA-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |