C13H17N — CID 143596129
ethane;4-ethenyl-1,8a-dihydroquinoline (PubChem CID 143596129) has the molecular formula C13H17N and a molecular weight of 187.29 g/mol. Its IUPAC name is ethane;4-ethenyl-1,8a-dihydroquinoline.
| Compound Name | ethane;4-ethenyl-1,8a-dihydroquinoline |
|---|---|
| PubChem CID | 143596129 |
| Molecular Formula | C13H17N |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | ethane;4-ethenyl-1,8a-dihydroquinoline |
| SMILES | C=CC1=C2C=CC=CC2NC=C1.CC |
| InChI | InChI=1S/C11H11N.C2H6/c1-2-9-7-8-12-11-6-4-3-5-10(9)11;1-2/h2-8,11-12H,1H2;1-2H3 |
| InChIKey | JRHBCNRUDQHXEO-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |