C9H18NO3Si- — CID 163620318
(5-aminocyclohexa-2,4-dien-1-yl)-trimethoxysilanuide (PubChem CID 163620318) has the molecular formula C9H18NO3Si- and a molecular weight of 216.33 g/mol. Its IUPAC name is (5-aminocyclohexa-2,4-dien-1-yl)-trimethoxysilanuide.
| Compound Name | (5-aminocyclohexa-2,4-dien-1-yl)-trimethoxysilanuide |
|---|---|
| PubChem CID | 163620318 |
| Molecular Formula | C9H18NO3Si- |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.11 |
| IUPAC Name | (5-aminocyclohexa-2,4-dien-1-yl)-trimethoxysilanuide |
| SMILES | CO[SiH-](OC)(OC)C1C=CC=C(N)C1 |
| InChI | InChI=1S/C9H18NO3Si/c1-11-14(12-2,13-3)9-6-4-5-8(10)7-9/h4-6,9,14H,7,10H2,1-3H3/q-1 |
| InChIKey | HNNXDIVACSWECA-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|