C14H18ClNO — CID 163807545
[5-chloro-2-(methylamino)cyclohexa-1,3-dien-1-yl]-cyclohexa-2,4-dien-1-ylmethanol (PubChem CID 163807545) has the molecular formula C14H18ClNO and a molecular weight of 251.76 g/mol. Its IUPAC name is [5-chloro-2-(methylamino)cyclohexa-1,3-dien-1-yl]-cyclohexa-2,4-dien-1-ylmethanol.
| Compound Name | [5-chloro-2-(methylamino)cyclohexa-1,3-dien-1-yl]-cyclohexa-2,4-dien-1-ylmethanol |
|---|---|
| PubChem CID | 163807545 |
| Molecular Formula | C14H18ClNO |
| Molecular Weight | 251.76 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | [5-chloro-2-(methylamino)cyclohexa-1,3-dien-1-yl]-cyclohexa-2,4-dien-1-ylmethanol |
| SMILES | CNC1=C(C(O)C2C=CC=CC2)CC(Cl)C=C1 |
| InChI | InChI=1S/C14H18ClNO/c1-16-13-8-7-11(15)9-12(13)14(17)10-5-3-2-4-6-10/h2-5,7-8,10-11,14,16-17H,6,9H2,1H3 |
| InChIKey | NKICRANTRVNJFI-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.76 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|