About N'-(2-nitrophenyl)-N'-phenyladamantane-1-carbohydrazide
N'-(2-nitrophenyl)-N'-phenyladamantane-1-carbohydrazide (PubChem CID 86346580) has the molecular formula C23H25N3O3
and a molecular weight of 391.47 g/mol. Its IUPAC name is N'-(2-nitrophenyl)-N'-phenyladamantane-1-carbohydrazide.
Molecular Properties
| Compound Name | N'-(2-nitrophenyl)-N'-phenyladamantane-1-carbohydrazide |
| PubChem CID | 86346580 |
| Molecular Formula | C23H25N3O3 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | N'-(2-nitrophenyl)-N'-phenyladamantane-1-carbohydrazide |
| SMILES | O=C(NN(c1ccccc1)c1ccccc1[N+](=O)[O-])C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C23H25N3O3/c27-22(23-13-16-10-17(14-23)12-18(11-16)15-23)24-25(19-6-2-1-3-7-19)20-8-4-5-9-21(20)26(28)29/h1-9,16-18H,10-15H2,(H,24,27) |
| InChIKey | LEYVUWPSMIOFGR-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-(2-nitrophenyl)-N'-phenyladamantane-1-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(2-nitrophenyl)-N'-phenyladamantane-1-carbohydrazide?
The IUPAC name of N'-(2-nitrophenyl)-N'-phenyladamantane-1-carbohydrazide (CID 86346580) is N'-(2-nitrophenyl)-N'-phenyladamantane-1-carbohydrazide.
What is the SMILES notation for N'-(2-nitrophenyl)-N'-phenyladamantane-1-carbohydrazide?
The canonical SMILES for N'-(2-nitrophenyl)-N'-phenyladamantane-1-carbohydrazide is O=C(NN(c1ccccc1)c1ccccc1[N+](=O)[O-])C12CC3CC(CC(C3)C1)C2.
What is the InChIKey of N'-(2-nitrophenyl)-N'-phenyladamantane-1-carbohydrazide?
The InChIKey is LEYVUWPSMIOFGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H25N3O3/c27-22(23-13-16-10-17(14-23)12-18(11-16)15-23)24-25(19-6-2-1-3-7-19)20-8-4-5-9-21(20)26(28)29/h1-9,16-18H,10-15H2,(H,24,27).
What are the key properties of N'-(2-nitrophenyl)-N'-phenyladamantane-1-carbohydrazide?
N'-(2-nitrophenyl)-N'-phenyladamantane-1-carbohydrazide has a molecular weight of 391.47 g/mol, XLogP of 4.98, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(2-nitrophenyl)-N'-phenyladamantane-1-carbohydrazide is sourced from PubChem (CID 86346580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).