C21H28N2O3S — CID 7689997
N'-[(3S)-1,1-dioxothiolan-3-yl]-N'-phenyladamantane-1-carbohydrazide (PubChem CID 7689997) has the molecular formula C21H28N2O3S and a molecular weight of 388.53 g/mol. Its IUPAC name is N'-[(3S)-1,1-dioxothiolan-3-yl]-N'-phenyladamantane-1-carbohydrazide.
| Compound Name | N'-[(3S)-1,1-dioxothiolan-3-yl]-N'-phenyladamantane-1-carbohydrazide |
|---|---|
| PubChem CID | 7689997 |
| Molecular Formula | C21H28N2O3S |
| Molecular Weight | 388.53 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | N'-[(3S)-1,1-dioxothiolan-3-yl]-N'-phenyladamantane-1-carbohydrazide |
| SMILES | O=C(NN(c1ccccc1)[C@H]1CCS(=O)(=O)C1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C21H28N2O3S/c24-20(21-11-15-8-16(12-21)10-17(9-15)13-21)22-23(18-4-2-1-3-5-18)19-6-7-27(25,26)14-19/h1-5,15-17,19H,6-14H2,(H,22,24)/t15?,16?,17?,19-,21?/m0/s1 |
| InChIKey | ZSAOKDICTJFINC-ILCGBQQYSA-N |
| XLogP | 2.93 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.53 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|