C13H18N2O3S — CID 102566727
N-(1,1-dioxothiolan-3-yl)-N'-ethylbenzohydrazide (PubChem CID 102566727) has the molecular formula C13H18N2O3S and a molecular weight of 282.36 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-N'-ethylbenzohydrazide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-N'-ethylbenzohydrazide |
|---|---|
| PubChem CID | 102566727 |
| Molecular Formula | C13H18N2O3S |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-N'-ethylbenzohydrazide |
| SMILES | CCNN(C(=O)c1ccccc1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H18N2O3S/c1-2-14-15(12-8-9-19(17,18)10-12)13(16)11-6-4-3-5-7-11/h3-7,12,14H,2,8-10H2,1H3 |
| InChIKey | IIZSLHSFLYYWTK-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|