About N-[(1,1-dioxo-2,5-dihydrothiophen-3-yl)methyl]-N-phenyladamantane-1-carboxamide
N-[(1,1-dioxo-2,5-dihydrothiophen-3-yl)methyl]-N-phenyladamantane-1-carboxamide (PubChem CID 4686994) has the molecular formula C22H27NO3S
and a molecular weight of 385.53 g/mol. Its IUPAC name is N-[(1,1-dioxo-2,5-dihydrothiophen-3-yl)methyl]-N-phenyladamantane-1-carboxamide.
Molecular Properties
| Compound Name | N-[(1,1-dioxo-2,5-dihydrothiophen-3-yl)methyl]-N-phenyladamantane-1-carboxamide |
| PubChem CID | 4686994 |
| Molecular Formula | C22H27NO3S |
| Molecular Weight | 385.53 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | N-[(1,1-dioxo-2,5-dihydrothiophen-3-yl)methyl]-N-phenyladamantane-1-carboxamide |
| SMILES | O=C(N(CC1=CCS(=O)(=O)C1)c1ccccc1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C22H27NO3S/c24-21(22-11-17-8-18(12-22)10-19(9-17)13-22)23(20-4-2-1-3-5-20)14-16-6-7-27(25,26)15-16/h1-6,17-19H,7-15H2 |
| InChIKey | PJCAHCDSQFPJSM-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.53 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[(1,1-dioxo-2,5-dihydrothiophen-3-yl)methyl]-N-phenyladamantane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1,1-dioxo-2,5-dihydrothiophen-3-yl)methyl]-N-phenyladamantane-1-carboxamide?
The IUPAC name of N-[(1,1-dioxo-2,5-dihydrothiophen-3-yl)methyl]-N-phenyladamantane-1-carboxamide (CID 4686994) is N-[(1,1-dioxo-2,5-dihydrothiophen-3-yl)methyl]-N-phenyladamantane-1-carboxamide.
What is the SMILES notation for N-[(1,1-dioxo-2,5-dihydrothiophen-3-yl)methyl]-N-phenyladamantane-1-carboxamide?
The canonical SMILES for N-[(1,1-dioxo-2,5-dihydrothiophen-3-yl)methyl]-N-phenyladamantane-1-carboxamide is O=C(N(CC1=CCS(=O)(=O)C1)c1ccccc1)C12CC3CC(CC(C3)C1)C2.
What is the InChIKey of N-[(1,1-dioxo-2,5-dihydrothiophen-3-yl)methyl]-N-phenyladamantane-1-carboxamide?
The InChIKey is PJCAHCDSQFPJSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H27NO3S/c24-21(22-11-17-8-18(12-22)10-19(9-17)13-22)23(20-4-2-1-3-5-20)14-16-6-7-27(25,26)15-16/h1-6,17-19H,7-15H2.
What are the key properties of N-[(1,1-dioxo-2,5-dihydrothiophen-3-yl)methyl]-N-phenyladamantane-1-carboxamide?
N-[(1,1-dioxo-2,5-dihydrothiophen-3-yl)methyl]-N-phenyladamantane-1-carboxamide has a molecular weight of 385.53 g/mol, XLogP of 3.59, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1,1-dioxo-2,5-dihydrothiophen-3-yl)methyl]-N-phenyladamantane-1-carboxamide is sourced from PubChem (CID 4686994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).