C24H27N2O+ — CID 8641105
[(1R)-2-(dimethylamino)-2-oxo-1-phenylethyl]-[(R)-(4-methylphenyl)-phenylmethyl]azanium (PubChem CID 8641105) has the molecular formula C24H27N2O+ and a molecular weight of 359.49 g/mol. Its IUPAC name is [(1R)-2-(dimethylamino)-2-oxo-1-phenylethyl]-[(R)-(4-methylphenyl)-phenylmethyl]azanium.
| Compound Name | [(1R)-2-(dimethylamino)-2-oxo-1-phenylethyl]-[(R)-(4-methylphenyl)-phenylmethyl]azanium |
|---|---|
| PubChem CID | 8641105 |
| Molecular Formula | C24H27N2O+ |
| Molecular Weight | 359.49 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | [(1R)-2-(dimethylamino)-2-oxo-1-phenylethyl]-[(R)-(4-methylphenyl)-phenylmethyl]azanium |
| SMILES | Cc1ccc([C@H]([NH2+][C@@H](C(=O)N(C)C)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H26N2O/c1-18-14-16-21(17-15-18)22(19-10-6-4-7-11-19)25-23(24(27)26(2)3)20-12-8-5-9-13-20/h4-17,22-23,25H,1-3H3/p+1/t22-,23-/m1/s1 |
| InChIKey | GGLUYEOLRLNXPK-DHIUTWEWSA-O |
| XLogP | 3.48 |
| TPSA | 36.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.49 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |